C13H20N4S — CID 56883514
N-(2-ethylsulfanylethyl)-2,3,5-trimethylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 56883514) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is N-(2-ethylsulfanylethyl)-2,3,5-trimethylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-(2-ethylsulfanylethyl)-2,3,5-trimethylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 56883514 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N-(2-ethylsulfanylethyl)-2,3,5-trimethylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCSCCNc1cc(C)nc2c(C)c(C)nn12 |
| InChI | InChI=1S/C13H20N4S/c1-5-18-7-6-14-12-8-9(2)15-13-10(3)11(4)16-17(12)13/h8,14H,5-7H2,1-4H3 |
| InChIKey | GGZXRRMQQRZKTG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|