C21H22N4O — CID 56883576
1-(1H-indol-2-yl)-N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-N-methylmethanamine (PubChem CID 56883576) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-(1H-indol-2-yl)-N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-N-methylmethanamine.
| Compound Name | 1-(1H-indol-2-yl)-N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 56883576 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-(1H-indol-2-yl)-N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-N-methylmethanamine |
| SMILES | COc1cccc(-n2cc(CN(C)Cc3cc4ccccc4[nH]3)cn2)c1 |
| InChI | InChI=1S/C21H22N4O/c1-24(15-18-10-17-6-3-4-9-21(17)23-18)13-16-12-22-25(14-16)19-7-5-8-20(11-19)26-2/h3-12,14,23H,13,15H2,1-2H3 |
| InChIKey | MPOYNFLBRACGEZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |