C17H25N3O3 — CID 56883612
ethyl 2-[1-[2-oxo-2-(pyridin-2-ylmethylamino)ethyl]piperidin-2-yl]acetate (PubChem CID 56883612) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is ethyl 2-[1-[2-oxo-2-(pyridin-2-ylmethylamino)ethyl]piperidin-2-yl]acetate.
| Compound Name | ethyl 2-[1-[2-oxo-2-(pyridin-2-ylmethylamino)ethyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 56883612 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | ethyl 2-[1-[2-oxo-2-(pyridin-2-ylmethylamino)ethyl]piperidin-2-yl]acetate |
| SMILES | CCOC(=O)CC1CCCCN1CC(=O)NCc1ccccn1 |
| InChI | InChI=1S/C17H25N3O3/c1-2-23-17(22)11-15-8-4-6-10-20(15)13-16(21)19-12-14-7-3-5-9-18-14/h3,5,7,9,15H,2,4,6,8,10-13H2,1H3,(H,19,21) |
| InChIKey | WKJNGJQVYJSORC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |