About 3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine
3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine (PubChem CID 56883779) has the molecular formula C17H25F2NO
and a molecular weight of 297.39 g/mol. Its IUPAC name is 3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine.
Molecular Properties
| Compound Name | 3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine |
| PubChem CID | 56883779 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine |
| SMILES | CCOCCN1CCCC(CCc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C17H25F2NO/c1-2-21-11-10-20-9-3-4-15(13-20)6-5-14-7-8-16(18)17(19)12-14/h7-8,12,15H,2-6,9-11,13H2,1H3 |
| InChIKey | XCYRXWBQYVMAEC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine?
The IUPAC name of 3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine (CID 56883779) is 3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine.
What is the SMILES notation for 3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine?
The canonical SMILES for 3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine is CCOCCN1CCCC(CCc2ccc(F)c(F)c2)C1.
What is the InChIKey of 3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine?
The InChIKey is XCYRXWBQYVMAEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F2NO/c1-2-21-11-10-20-9-3-4-15(13-20)6-5-14-7-8-16(18)17(19)12-14/h7-8,12,15H,2-6,9-11,13H2,1H3.
What are the key properties of 3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine?
3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine has a molecular weight of 297.39 g/mol, XLogP of 3.65, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-difluorophenyl)ethyl]-1-(2-ethoxyethyl)piperidine is sourced from PubChem (CID 56883779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).