C21H28N4O2 — CID 56883840
1-[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethanone (PubChem CID 56883840) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 56883840 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1-[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethanone |
| SMILES | Cc1nc(C)n(CC(=O)N2CC[C@@](O)(c3ccccc3)[C@H]3CCCC[C@@H]32)n1 |
| InChI | InChI=1S/C21H28N4O2/c1-15-22-16(2)25(23-15)14-20(26)24-13-12-21(27,17-8-4-3-5-9-17)18-10-6-7-11-19(18)24/h3-5,8-9,18-19,27H,6-7,10-14H2,1-2H3/t18-,19-,21+/m0/s1 |
| InChIKey | BJFQNPOMKOCLPU-IRFCIJBXSA-N |
| XLogP | 2.57 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |