C19H30N4O2 — CID 56883947
(4aS,8aR)-1-(3-methoxypropyl)-6-(5-propylpyrimidin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56883947) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is (4aS,8aR)-1-(3-methoxypropyl)-6-(5-propylpyrimidin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(3-methoxypropyl)-6-(5-propylpyrimidin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56883947 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (4aS,8aR)-1-(3-methoxypropyl)-6-(5-propylpyrimidin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CCCc1cncnc1N1CC[C@@H]2[C@@H](CCC(=O)N2CCCOC)C1 |
| InChI | InChI=1S/C19H30N4O2/c1-3-5-15-12-20-14-21-19(15)22-10-8-17-16(13-22)6-7-18(24)23(17)9-4-11-25-2/h12,14,16-17H,3-11,13H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | KJAXEYBKYYPLPJ-DLBZAZTESA-N |
| XLogP | 2.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|