About ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate
ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate (PubChem CID 56884029) has the molecular formula C17H25N5O2
and a molecular weight of 331.42 g/mol. Its IUPAC name is ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate |
| PubChem CID | 56884029 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1(Nc2nc(C)nc3c2cnn3C)CCCCC1 |
| InChI | InChI=1S/C17H25N5O2/c1-4-24-14(23)10-17(8-6-5-7-9-17)21-15-13-11-18-22(3)16(13)20-12(2)19-15/h11H,4-10H2,1-3H3,(H,19,20,21) |
| InChIKey | SLPUTABXWLCFNQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate?
The IUPAC name of ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate (CID 56884029) is ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate.
What is the SMILES notation for ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate?
The canonical SMILES for ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate is CCOC(=O)CC1(Nc2nc(C)nc3c2cnn3C)CCCCC1.
What is the InChIKey of ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate?
The InChIKey is SLPUTABXWLCFNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5O2/c1-4-24-14(23)10-17(8-6-5-7-9-17)21-15-13-11-18-22(3)16(13)20-12(2)19-15/h11H,4-10H2,1-3H3,(H,19,20,21).
What are the key properties of ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate?
ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate has a molecular weight of 331.42 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1-[(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]cyclohexyl]acetate is sourced from PubChem (CID 56884029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).