C19H31N3O2 — CID 56884066
(4aS,8aR)-1-(3-aminopropyl)-6-[2-(cyclohexen-1-yl)acetyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56884066) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is (4aS,8aR)-1-(3-aminopropyl)-6-[2-(cyclohexen-1-yl)acetyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(3-aminopropyl)-6-[2-(cyclohexen-1-yl)acetyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56884066 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | (4aS,8aR)-1-(3-aminopropyl)-6-[2-(cyclohexen-1-yl)acetyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | NCCCN1C(=O)CC[C@H]2CN(C(=O)CC3=CCCCC3)CC[C@H]21 |
| InChI | InChI=1S/C19H31N3O2/c20-10-4-11-22-17-9-12-21(14-16(17)7-8-18(22)23)19(24)13-15-5-2-1-3-6-15/h5,16-17H,1-4,6-14,20H2/t16-,17+/m0/s1 |
| InChIKey | ZRFOCNRCACNDTR-DLBZAZTESA-N |
| XLogP | 2.07 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|