C20H31N5 — CID 56884354
4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-cyclopentyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine (PubChem CID 56884354) has the molecular formula C20H31N5 and a molecular weight of 341.50 g/mol. Its IUPAC name is 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-cyclopentyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine.
| Compound Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-cyclopentyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine |
|---|---|
| PubChem CID | 56884354 |
| Molecular Formula | C20H31N5 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-cyclopentyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine |
| SMILES | C1CCC(c2nc3c(c(N4CCN5CCCC5C4)n2)CCNCC3)C1 |
| InChI | InChI=1S/C20H31N5/c1-2-5-15(4-1)19-22-18-8-10-21-9-7-17(18)20(23-19)25-13-12-24-11-3-6-16(24)14-25/h15-16,21H,1-14H2 |
| InChIKey | JXSIGTLUGUEBTD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |