About 1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide
1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide (PubChem CID 56884395) has the molecular formula C18H23N5O3
and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide.
Molecular Properties
| Compound Name | 1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide |
| PubChem CID | 56884395 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide |
| SMILES | CCc1nc(C)c(C(=O)N2CCNCC2C(=O)NCc2ccncc2)o1 |
| InChI | InChI=1S/C18H23N5O3/c1-3-15-22-12(2)16(26-15)18(25)23-9-8-20-11-14(23)17(24)21-10-13-4-6-19-7-5-13/h4-7,14,20H,3,8-11H2,1-2H3,(H,21,24) |
| InChIKey | ITKZCKHPMLWOQH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide?
The IUPAC name of 1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide (CID 56884395) is 1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide.
What is the SMILES notation for 1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide?
The canonical SMILES for 1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide is CCc1nc(C)c(C(=O)N2CCNCC2C(=O)NCc2ccncc2)o1.
What is the InChIKey of 1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide?
The InChIKey is ITKZCKHPMLWOQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5O3/c1-3-15-22-12(2)16(26-15)18(25)23-9-8-20-11-14(23)17(24)21-10-13-4-6-19-7-5-13/h4-7,14,20H,3,8-11H2,1-2H3,(H,21,24).
What are the key properties of 1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide?
1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide has a molecular weight of 357.41 g/mol, XLogP of 0.67, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethyl-4-methyl-1,3-oxazole-5-carbonyl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide is sourced from PubChem (CID 56884395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).