C20H23N5O — CID 56884537
1-[3-[(2-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl)amino]propyl]pyrrolidin-2-one (PubChem CID 56884537) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-[3-[(2-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl)amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(2-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl)amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 56884537 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 1-[3-[(2-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl)amino]propyl]pyrrolidin-2-one |
| SMILES | Cc1cc2nc(-c3ccccc3)cc(NCCCN3CCCC3=O)n2n1 |
| InChI | InChI=1S/C20H23N5O/c1-15-13-19-22-17(16-7-3-2-4-8-16)14-18(25(19)23-15)21-10-6-12-24-11-5-9-20(24)26/h2-4,7-8,13-14,21H,5-6,9-12H2,1H3 |
| InChIKey | TVBJUJMYBSOAIG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|