C20H23N3O3 — CID 56884666
3-(1,3-benzodioxol-5-yl)-N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]propanamide (PubChem CID 56884666) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 56884666 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]propanamide |
| SMILES | Cc1ncc2c(c1CNC(=O)CCc1ccc3c(c1)OCO3)CCNC2 |
| InChI | InChI=1S/C20H23N3O3/c1-13-17(16-6-7-21-9-15(16)10-22-13)11-23-20(24)5-3-14-2-4-18-19(8-14)26-12-25-18/h2,4,8,10,21H,3,5-7,9,11-12H2,1H3,(H,23,24) |
| InChIKey | QFGJFEVAHXOJNH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |