C15H23N3 — CID 56884723
(3aR,7aS)-2-[3-(4-methylpyrazol-1-yl)propyl]-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 56884723) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is (3aR,7aS)-2-[3-(4-methylpyrazol-1-yl)propyl]-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | (3aR,7aS)-2-[3-(4-methylpyrazol-1-yl)propyl]-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 56884723 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | (3aR,7aS)-2-[3-(4-methylpyrazol-1-yl)propyl]-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | Cc1cnn(CCCN2C[C@H]3CC=CC[C@H]3C2)c1 |
| InChI | InChI=1S/C15H23N3/c1-13-9-16-18(10-13)8-4-7-17-11-14-5-2-3-6-15(14)12-17/h2-3,9-10,14-15H,4-8,11-12H2,1H3/t14-,15+ |
| InChIKey | DFVJLIRTDNAVKU-GASCZTMLSA-N |
| XLogP | 2.48 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|