C16H18N8S — CID 56884765
4-N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 56884765) has the molecular formula C16H18N8S and a molecular weight of 354.44 g/mol. Its IUPAC name is 4-N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 56884765 |
| Molecular Formula | C16H18N8S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 4-N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | Nc1nc2c(c(NCc3csc(-c4cnccn4)n3)n1)CCNCC2 |
| InChI | InChI=1S/C16H18N8S/c17-16-23-12-2-4-18-3-1-11(12)14(24-16)21-7-10-9-25-15(22-10)13-8-19-5-6-20-13/h5-6,8-9,18H,1-4,7H2,(H3,17,21,23,24) |
| InChIKey | AZMJVRZKMFEWDY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |