C16H18N6O2 — CID 56885089
1-(pyridazine-3-carbonyl)-N-(pyridin-2-ylmethyl)piperazine-2-carboxamide (PubChem CID 56885089) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-(pyridazine-3-carbonyl)-N-(pyridin-2-ylmethyl)piperazine-2-carboxamide.
| Compound Name | 1-(pyridazine-3-carbonyl)-N-(pyridin-2-ylmethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 56885089 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-(pyridazine-3-carbonyl)-N-(pyridin-2-ylmethyl)piperazine-2-carboxamide |
| SMILES | O=C(NCc1ccccn1)C1CNCCN1C(=O)c1cccnn1 |
| InChI | InChI=1S/C16H18N6O2/c23-15(19-10-12-4-1-2-6-18-12)14-11-17-8-9-22(14)16(24)13-5-3-7-20-21-13/h1-7,14,17H,8-11H2,(H,19,23) |
| InChIKey | FIBRAJHIYZLLJN-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |