C19H23ClN2O3 — CID 56885233
2-chloro-6-methoxy-4-[[3-(pyridin-3-ylmethoxy)piperidin-1-yl]methyl]phenol (PubChem CID 56885233) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is 2-chloro-6-methoxy-4-[[3-(pyridin-3-ylmethoxy)piperidin-1-yl]methyl]phenol.
| Compound Name | 2-chloro-6-methoxy-4-[[3-(pyridin-3-ylmethoxy)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 56885233 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-chloro-6-methoxy-4-[[3-(pyridin-3-ylmethoxy)piperidin-1-yl]methyl]phenol |
| SMILES | COc1cc(CN2CCCC(OCc3cccnc3)C2)cc(Cl)c1O |
| InChI | InChI=1S/C19H23ClN2O3/c1-24-18-9-15(8-17(20)19(18)23)11-22-7-3-5-16(12-22)25-13-14-4-2-6-21-10-14/h2,4,6,8-10,16,23H,3,5,7,11-13H2,1H3 |
| InChIKey | CQJHHOYWUFCXHQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |