C11H18N2O3S — CID 56886108
(3aS,6aR)-5-(3-methylsulfanylpropyl)-3-oxo-2,3a,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-6a-carboxylic acid (PubChem CID 56886108) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is (3aS,6aR)-5-(3-methylsulfanylpropyl)-3-oxo-2,3a,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-6a-carboxylic acid.
| Compound Name | (3aS,6aR)-5-(3-methylsulfanylpropyl)-3-oxo-2,3a,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-6a-carboxylic acid |
|---|---|
| PubChem CID | 56886108 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (3aS,6aR)-5-(3-methylsulfanylpropyl)-3-oxo-2,3a,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-6a-carboxylic acid |
| SMILES | CSCCCN1C[C@H]2C(=O)NC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C11H18N2O3S/c1-17-4-2-3-13-5-8-9(14)12-6-11(8,7-13)10(15)16/h8H,2-7H2,1H3,(H,12,14)(H,15,16)/t8-,11+/m0/s1 |
| InChIKey | JAVTWAVEMPWXCO-GZMMTYOYSA-N |
| XLogP | -0.13 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|