C19H29N3O2 — CID 56886302
(4aS,8aR)-1-butyl-6-(3-pyrrol-1-ylpropanoyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56886302) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (4aS,8aR)-1-butyl-6-(3-pyrrol-1-ylpropanoyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-butyl-6-(3-pyrrol-1-ylpropanoyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56886302 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | (4aS,8aR)-1-butyl-6-(3-pyrrol-1-ylpropanoyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CCCCN1C(=O)CC[C@H]2CN(C(=O)CCn3cccc3)CC[C@H]21 |
| InChI | InChI=1S/C19H29N3O2/c1-2-3-12-22-17-8-14-21(15-16(17)6-7-19(22)24)18(23)9-13-20-10-4-5-11-20/h4-5,10-11,16-17H,2-3,6-9,12-15H2,1H3/t16-,17+/m0/s1 |
| InChIKey | HTJHTUIFZWOPRG-DLBZAZTESA-N |
| XLogP | 2.52 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |