C16H27N5O — CID 56886341
(4aS,8aR)-1-[2-(methylamino)ethyl]-6-[(2-methyl-1H-imidazol-5-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56886341) has the molecular formula C16H27N5O and a molecular weight of 305.43 g/mol. Its IUPAC name is (4aS,8aR)-1-[2-(methylamino)ethyl]-6-[(2-methyl-1H-imidazol-5-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-6-[(2-methyl-1H-imidazol-5-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56886341 |
| Molecular Formula | C16H27N5O |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-6-[(2-methyl-1H-imidazol-5-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(Cc3cnc(C)[nH]3)CC[C@H]21 |
| InChI | InChI=1S/C16H27N5O/c1-12-18-9-14(19-12)11-20-7-5-15-13(10-20)3-4-16(22)21(15)8-6-17-2/h9,13,15,17H,3-8,10-11H2,1-2H3,(H,18,19)/t13-,15+/m0/s1 |
| InChIKey | VYJREUVKJMRWLZ-DZGCQCFKSA-N |
| XLogP | 0.75 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |