C22H29N5O — CID 56886404
3-[5-(2,2-dimethyl-3-morpholin-4-ylpropyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]benzonitrile (PubChem CID 56886404) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 3-[5-(2,2-dimethyl-3-morpholin-4-ylpropyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]benzonitrile.
| Compound Name | 3-[5-(2,2-dimethyl-3-morpholin-4-ylpropyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 56886404 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 3-[5-(2,2-dimethyl-3-morpholin-4-ylpropyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]benzonitrile |
| SMILES | CC(C)(CN1CCOCC1)CN1CCc2[nH]cnc2C1c1cccc(C#N)c1 |
| InChI | InChI=1S/C22H29N5O/c1-22(2,14-26-8-10-28-11-9-26)15-27-7-6-19-20(25-16-24-19)21(27)18-5-3-4-17(12-18)13-23/h3-5,12,16,21H,6-11,14-15H2,1-2H3,(H,24,25) |
| InChIKey | UNIPZZSILGFMBX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |