C18H16FN5S — CID 56886548
4-(4-fluorophenyl)sulfanyl-6-(3-pyridin-3-ylazetidin-1-yl)pyrimidin-2-amine (PubChem CID 56886548) has the molecular formula C18H16FN5S and a molecular weight of 353.43 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfanyl-6-(3-pyridin-3-ylazetidin-1-yl)pyrimidin-2-amine.
| Compound Name | 4-(4-fluorophenyl)sulfanyl-6-(3-pyridin-3-ylazetidin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 56886548 |
| Molecular Formula | C18H16FN5S |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-(4-fluorophenyl)sulfanyl-6-(3-pyridin-3-ylazetidin-1-yl)pyrimidin-2-amine |
| SMILES | Nc1nc(Sc2ccc(F)cc2)cc(N2CC(c3cccnc3)C2)n1 |
| InChI | InChI=1S/C18H16FN5S/c19-14-3-5-15(6-4-14)25-17-8-16(22-18(20)23-17)24-10-13(11-24)12-2-1-7-21-9-12/h1-9,13H,10-11H2,(H2,20,22,23) |
| InChIKey | DPCGBDDXMMVLCL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |