About 1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane
1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane (PubChem CID 56886664) has the molecular formula C19H23N5S
and a molecular weight of 353.50 g/mol. Its IUPAC name is 1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane.
Molecular Properties
| Compound Name | 1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane |
| PubChem CID | 56886664 |
| Molecular Formula | C19H23N5S |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane |
| SMILES | c1ccc(-n2cc(CN3CCCN(Cc4cccs4)CC3)nn2)cc1 |
| InChI | InChI=1S/C19H23N5S/c1-2-6-18(7-3-1)24-15-17(20-21-24)14-22-9-5-10-23(12-11-22)16-19-8-4-13-25-19/h1-4,6-8,13,15H,5,9-12,14,16H2 |
| InChIKey | CYYXVUMHDQZCMM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane?
The IUPAC name of 1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane (CID 56886664) is 1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane.
What is the SMILES notation for 1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane?
The canonical SMILES for 1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane is c1ccc(-n2cc(CN3CCCN(Cc4cccs4)CC3)nn2)cc1.
What is the InChIKey of 1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane?
The InChIKey is CYYXVUMHDQZCMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N5S/c1-2-6-18(7-3-1)24-15-17(20-21-24)14-22-9-5-10-23(12-11-22)16-19-8-4-13-25-19/h1-4,6-8,13,15H,5,9-12,14,16H2.
What are the key properties of 1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane?
1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane has a molecular weight of 353.50 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-phenyltriazol-4-yl)methyl]-4-(thiophen-2-ylmethyl)-1,4-diazepane is sourced from PubChem (CID 56886664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).