C19H29N5O2 — CID 56886791
(4aS,8aR)-6-(5-methyl-1H-imidazole-4-carbonyl)-1-(piperidin-4-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56886791) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (4aS,8aR)-6-(5-methyl-1H-imidazole-4-carbonyl)-1-(piperidin-4-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-(5-methyl-1H-imidazole-4-carbonyl)-1-(piperidin-4-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56886791 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | (4aS,8aR)-6-(5-methyl-1H-imidazole-4-carbonyl)-1-(piperidin-4-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | Cc1[nH]cnc1C(=O)N1CC[C@@H]2[C@@H](CCC(=O)N2CC2CCNCC2)C1 |
| InChI | InChI=1S/C19H29N5O2/c1-13-18(22-12-21-13)19(26)23-9-6-16-15(11-23)2-3-17(25)24(16)10-14-4-7-20-8-5-14/h12,14-16,20H,2-11H2,1H3,(H,21,22)/t15-,16+/m0/s1 |
| InChIKey | KWDJCJZAPKHVHU-JKSUJKDBSA-N |
| XLogP | 1.17 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |