C18H23N3O2S — CID 56887063
methyl 4-[[4-[(3-methyl-2-pyridinyl)methyl]piperazin-1-yl]methyl]thiophene-2-carboxylate (PubChem CID 56887063) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is methyl 4-[[4-[(3-methyl-2-pyridinyl)methyl]piperazin-1-yl]methyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-[[4-[(3-methyl-2-pyridinyl)methyl]piperazin-1-yl]methyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 56887063 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | methyl 4-[[4-[(3-methyl-2-pyridinyl)methyl]piperazin-1-yl]methyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(CN2CCN(Cc3ncccc3C)CC2)cs1 |
| InChI | InChI=1S/C18H23N3O2S/c1-14-4-3-5-19-16(14)12-21-8-6-20(7-9-21)11-15-10-17(24-13-15)18(22)23-2/h3-5,10,13H,6-9,11-12H2,1-2H3 |
| InChIKey | GGZOHRICBXAQSS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |