C21H29NO3 — CID 56887606
[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(oxan-4-yl)methanone (PubChem CID 56887606) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is [(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(oxan-4-yl)methanone.
| Compound Name | [(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 56887606 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | [(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(oxan-4-yl)methanone |
| SMILES | O=C(C1CCOCC1)N1CC[C@@](O)(c2ccccc2)[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C21H29NO3/c23-20(16-10-14-25-15-11-16)22-13-12-21(24,17-6-2-1-3-7-17)18-8-4-5-9-19(18)22/h1-3,6-7,16,18-19,24H,4-5,8-15H2/t18-,19-,21+/m0/s1 |
| InChIKey | KMDKVRBTSXDOID-IRFCIJBXSA-N |
| XLogP | 3.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |