C19H21N5OS — CID 56888072
N,5-dimethyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 56888072) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is N,5-dimethyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | N,5-dimethyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56888072 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N,5-dimethyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | CN1CCc2[nH]nc(C(=O)N(C)Cc3csc(-c4ccccc4)n3)c2C1 |
| InChI | InChI=1S/C19H21N5OS/c1-23-9-8-16-15(11-23)17(22-21-16)19(25)24(2)10-14-12-26-18(20-14)13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3,(H,21,22) |
| InChIKey | AEVFSMZCUUEZQJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |