C17H15N3O5 — CID 56888205
(3aS,6aR)-3-oxo-5-(3-phenyl-1,2-oxazole-5-carbonyl)-2,3a,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-6a-carboxylic acid (PubChem CID 56888205) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is (3aS,6aR)-3-oxo-5-(3-phenyl-1,2-oxazole-5-carbonyl)-2,3a,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-6a-carboxylic acid.
| Compound Name | (3aS,6aR)-3-oxo-5-(3-phenyl-1,2-oxazole-5-carbonyl)-2,3a,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-6a-carboxylic acid |
|---|---|
| PubChem CID | 56888205 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (3aS,6aR)-3-oxo-5-(3-phenyl-1,2-oxazole-5-carbonyl)-2,3a,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-6a-carboxylic acid |
| SMILES | O=C1NC[C@@]2(C(=O)O)CN(C(=O)c3cc(-c4ccccc4)no3)C[C@@H]12 |
| InChI | InChI=1S/C17H15N3O5/c21-14-11-7-20(9-17(11,8-18-14)16(23)24)15(22)13-6-12(19-25-13)10-4-2-1-3-5-10/h1-6,11H,7-9H2,(H,18,21)(H,23,24)/t11-,17+/m0/s1 |
| InChIKey | RHBGTGHMVOOENM-APPDUMDISA-N |
| XLogP | 0.61 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |