C20H26N6O — CID 56888522
1-[3-[(6-cyclopentyl-1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]propyl]-6-methylpyridin-2-one (PubChem CID 56888522) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is 1-[3-[(6-cyclopentyl-1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]propyl]-6-methylpyridin-2-one.
| Compound Name | 1-[3-[(6-cyclopentyl-1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]propyl]-6-methylpyridin-2-one |
|---|---|
| PubChem CID | 56888522 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 1-[3-[(6-cyclopentyl-1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]propyl]-6-methylpyridin-2-one |
| SMILES | Cc1cccc(=O)n1CCCNc1nc(C2CCCC2)nc2c1cnn2C |
| InChI | InChI=1S/C20H26N6O/c1-14-7-5-10-17(27)26(14)12-6-11-21-19-16-13-22-25(2)20(16)24-18(23-19)15-8-3-4-9-15/h5,7,10,13,15H,3-4,6,8-9,11-12H2,1-2H3,(H,21,23,24) |
| InChIKey | HVSSNYZVDVJVFX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|