About 5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide
5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide (PubChem CID 56889219) has the molecular formula C22H21N3O2
and a molecular weight of 359.43 g/mol. Its IUPAC name is 5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide.
Molecular Properties
| Compound Name | 5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide |
| PubChem CID | 56889219 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide |
| SMILES | Cc1c(C(=O)N(C)Cc2cccc3ncccc23)c2cc(O)ccc2n1C |
| InChI | InChI=1S/C22H21N3O2/c1-14-21(18-12-16(26)9-10-20(18)25(14)3)22(27)24(2)13-15-6-4-8-19-17(15)7-5-11-23-19/h4-12,26H,13H2,1-3H3 |
| InChIKey | MRGCRVPYCGEKMD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide?
The IUPAC name of 5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide (CID 56889219) is 5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide.
What is the SMILES notation for 5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide?
The canonical SMILES for 5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide is Cc1c(C(=O)N(C)Cc2cccc3ncccc23)c2cc(O)ccc2n1C.
What is the InChIKey of 5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide?
The InChIKey is MRGCRVPYCGEKMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O2/c1-14-21(18-12-16(26)9-10-20(18)25(14)3)22(27)24(2)13-15-6-4-8-19-17(15)7-5-11-23-19/h4-12,26H,13H2,1-3H3.
What are the key properties of 5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide?
5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide has a molecular weight of 359.43 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-N,1,2-trimethyl-N-(quinolin-5-ylmethyl)indole-3-carboxamide is sourced from PubChem (CID 56889219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).