C34H40N2 — CID 568893
2,2,4,7-tetramethyl-1-[[4-[(2,2,4,7-tetramethylquinolin-1-yl)methyl]phenyl]methyl]quinoline (PubChem CID 568893) has the molecular formula C34H40N2 and a molecular weight of 476.71 g/mol. Its IUPAC name is 2,2,4,7-tetramethyl-1-[[4-[(2,2,4,7-tetramethylquinolin-1-yl)methyl]phenyl]methyl]quinoline.
| Compound Name | 2,2,4,7-tetramethyl-1-[[4-[(2,2,4,7-tetramethylquinolin-1-yl)methyl]phenyl]methyl]quinoline |
|---|---|
| PubChem CID | 568893 |
| Molecular Formula | C34H40N2 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | 2,2,4,7-tetramethyl-1-[[4-[(2,2,4,7-tetramethylquinolin-1-yl)methyl]phenyl]methyl]quinoline |
| SMILES | CC1=CC(C)(C)N(Cc2ccc(CN3c4cc(C)ccc4C(C)=CC3(C)C)cc2)c2cc(C)ccc21 |
| InChI | InChI=1S/C34H40N2/c1-23-9-15-29-25(3)19-33(5,6)35(31(29)17-23)21-27-11-13-28(14-12-27)22-36-32-18-24(2)10-16-30(32)26(4)20-34(36,7)8/h9-20H,21-22H2,1-8H3 |
| InChIKey | GXMZQABLXLJBNS-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |