C16H19ClN4O4 — CID 56889319
4-[2-[4-(2-chloropyridine-4-carbonyl)morpholin-3-yl]acetyl]piperazin-2-one (PubChem CID 56889319) has the molecular formula C16H19ClN4O4 and a molecular weight of 366.81 g/mol. Its IUPAC name is 4-[2-[4-(2-chloropyridine-4-carbonyl)morpholin-3-yl]acetyl]piperazin-2-one.
| Compound Name | 4-[2-[4-(2-chloropyridine-4-carbonyl)morpholin-3-yl]acetyl]piperazin-2-one |
|---|---|
| PubChem CID | 56889319 |
| Molecular Formula | C16H19ClN4O4 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 4-[2-[4-(2-chloropyridine-4-carbonyl)morpholin-3-yl]acetyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)CC2COCCN2C(=O)c2ccnc(Cl)c2)CCN1 |
| InChI | InChI=1S/C16H19ClN4O4/c17-13-7-11(1-2-18-13)16(24)21-5-6-25-10-12(21)8-15(23)20-4-3-19-14(22)9-20/h1-2,7,12H,3-6,8-10H2,(H,19,22) |
| InChIKey | QEDZLBLKVFWINJ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|