About 1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine
1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine (PubChem CID 56889639) has the molecular formula C18H26N4S
and a molecular weight of 330.50 g/mol. Its IUPAC name is 1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine.
Molecular Properties
| Compound Name | 1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine |
| PubChem CID | 56889639 |
| Molecular Formula | C18H26N4S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine |
| SMILES | Cc1nnc(CN(CCc2ccccc2)C2CCN(C)CC2)s1 |
| InChI | InChI=1S/C18H26N4S/c1-15-19-20-18(23-15)14-22(17-9-11-21(2)12-10-17)13-8-16-6-4-3-5-7-16/h3-7,17H,8-14H2,1-2H3 |
| InChIKey | SPQIYZUHXDRNRM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine?
The IUPAC name of 1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine (CID 56889639) is 1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine.
What is the SMILES notation for 1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine?
The canonical SMILES for 1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine is Cc1nnc(CN(CCc2ccccc2)C2CCN(C)CC2)s1.
What is the InChIKey of 1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine?
The InChIKey is SPQIYZUHXDRNRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N4S/c1-15-19-20-18(23-15)14-22(17-9-11-21(2)12-10-17)13-8-16-6-4-3-5-7-16/h3-7,17H,8-14H2,1-2H3.
What are the key properties of 1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine?
1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine has a molecular weight of 330.50 g/mol, XLogP of 2.99, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-phenylethyl)piperidin-4-amine is sourced from PubChem (CID 56889639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).