C13H20N4O2 — CID 56889648
N-(2-methylpropyl)-2-oxo-2-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)acetamide (PubChem CID 56889648) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-oxo-2-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)acetamide.
| Compound Name | N-(2-methylpropyl)-2-oxo-2-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)acetamide |
|---|---|
| PubChem CID | 56889648 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-(2-methylpropyl)-2-oxo-2-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)acetamide |
| SMILES | CC(C)CNC(=O)C(=O)N1CCCn2cncc2C1 |
| InChI | InChI=1S/C13H20N4O2/c1-10(2)6-15-12(18)13(19)16-4-3-5-17-9-14-7-11(17)8-16/h7,9-10H,3-6,8H2,1-2H3,(H,15,18) |
| InChIKey | GFYBNKUZDKTQFW-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|