About 2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one
2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one (PubChem CID 56889724) has the molecular formula C12H19N3O3
and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one.
Molecular Properties
| Compound Name | 2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one |
| PubChem CID | 56889724 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one |
| SMILES | O=c1cc(N2CCCCC2)cnn1C[C@H](O)CO |
| InChI | InChI=1S/C12H19N3O3/c16-9-11(17)8-15-12(18)6-10(7-13-15)14-4-2-1-3-5-14/h6-7,11,16-17H,1-5,8-9H2/t11-/m0/s1 |
| InChIKey | MYSOSNNANBZJAH-NSHDSACASA-N |
| XLogP | -0.41 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one?
The IUPAC name of 2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one (CID 56889724) is 2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one.
What is the SMILES notation for 2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one?
The canonical SMILES for 2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one is O=c1cc(N2CCCCC2)cnn1C[C@H](O)CO.
What is the InChIKey of 2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one?
The InChIKey is MYSOSNNANBZJAH-NSHDSACASA-N. The full InChI is InChI=1S/C12H19N3O3/c16-9-11(17)8-15-12(18)6-10(7-13-15)14-4-2-1-3-5-14/h6-7,11,16-17H,1-5,8-9H2/t11-/m0/s1.
What are the key properties of 2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one?
2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one has a molecular weight of 253.30 g/mol, XLogP of -0.41, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-2,3-dihydroxypropyl]-5-piperidin-1-ylpyridazin-3-one is sourced from PubChem (CID 56889724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).