C16H18F6N2O — CID 56890004
N-[(1S,2R)-2-(propan-2-ylamino)cyclobutyl]-2,4-bis(trifluoromethyl)benzamide (PubChem CID 56890004) has the molecular formula C16H18F6N2O and a molecular weight of 368.32 g/mol. Its IUPAC name is N-[(1S,2R)-2-(propan-2-ylamino)cyclobutyl]-2,4-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(1S,2R)-2-(propan-2-ylamino)cyclobutyl]-2,4-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 56890004 |
| Molecular Formula | C16H18F6N2O |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[(1S,2R)-2-(propan-2-ylamino)cyclobutyl]-2,4-bis(trifluoromethyl)benzamide |
| SMILES | CC(C)N[C@@H]1CC[C@@H]1NC(=O)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C16H18F6N2O/c1-8(2)23-12-5-6-13(12)24-14(25)10-4-3-9(15(17,18)19)7-11(10)16(20,21)22/h3-4,7-8,12-13,23H,5-6H2,1-2H3,(H,24,25)/t12-,13+/m1/s1 |
| InChIKey | ONTIXTDXMYUNIF-OLZOCXBDSA-N |
| XLogP | 3.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |