C20H34N4OS — CID 56890092
[(4aS,8aR)-6-[(2-ethylpyrimidin-4-yl)methyl]-1-(3-methylsulfanylpropyl)-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4a-yl]methanol (PubChem CID 56890092) has the molecular formula C20H34N4OS and a molecular weight of 378.59 g/mol. Its IUPAC name is [(4aS,8aR)-6-[(2-ethylpyrimidin-4-yl)methyl]-1-(3-methylsulfanylpropyl)-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aR)-6-[(2-ethylpyrimidin-4-yl)methyl]-1-(3-methylsulfanylpropyl)-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 56890092 |
| Molecular Formula | C20H34N4OS |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | [(4aS,8aR)-6-[(2-ethylpyrimidin-4-yl)methyl]-1-(3-methylsulfanylpropyl)-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4a-yl]methanol |
| SMILES | CCc1nccc(CN2CC[C@H]3N(CCCSC)CCC[C@]3(CO)C2)n1 |
| InChI | InChI=1S/C20H34N4OS/c1-3-19-21-9-6-17(22-19)14-23-12-7-18-20(15-23,16-25)8-4-10-24(18)11-5-13-26-2/h6,9,18,25H,3-5,7-8,10-16H2,1-2H3/t18-,20-/m1/s1 |
| InChIKey | XNCOOVQSBAANIF-UYAOXDASSA-N |
| XLogP | 2.44 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|