C18H30N4O2 — CID 56890410
N,N,5-trimethyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine (PubChem CID 56890410) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is N,N,5-trimethyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine.
| Compound Name | N,N,5-trimethyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 56890410 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | N,N,5-trimethyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine |
| SMILES | C=CCCC(CN1CCCOCC1)Oc1ncc(C)c(N(C)C)n1 |
| InChI | InChI=1S/C18H30N4O2/c1-5-6-8-16(14-22-9-7-11-23-12-10-22)24-18-19-13-15(2)17(20-18)21(3)4/h5,13,16H,1,6-12,14H2,2-4H3 |
| InChIKey | RMCCOJCOTIIQHZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|