C20H27N3OS — CID 56890722
(4aS,8aR)-1-(3-aminopropyl)-6-(1-benzothiophen-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56890722) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is (4aS,8aR)-1-(3-aminopropyl)-6-(1-benzothiophen-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(3-aminopropyl)-6-(1-benzothiophen-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56890722 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (4aS,8aR)-1-(3-aminopropyl)-6-(1-benzothiophen-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | NCCCN1C(=O)CC[C@H]2CN(Cc3cc4ccccc4s3)CC[C@H]21 |
| InChI | InChI=1S/C20H27N3OS/c21-9-3-10-23-18-8-11-22(13-16(18)6-7-20(23)24)14-17-12-15-4-1-2-5-19(15)25-17/h1-2,4-5,12,16,18H,3,6-11,13-14,21H2/t16-,18+/m0/s1 |
| InChIKey | MLHFOKQVSSVZEX-FUHWJXTLSA-N |
| XLogP | 3.06 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |