C19H28N4O2 — CID 56891203
2-cyclopent-2-en-1-yl-1-[4-(3-methoxypropylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethanone (PubChem CID 56891203) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-1-[4-(3-methoxypropylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethanone.
| Compound Name | 2-cyclopent-2-en-1-yl-1-[4-(3-methoxypropylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethanone |
|---|---|
| PubChem CID | 56891203 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-1-[4-(3-methoxypropylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethanone |
| SMILES | COCCCNc1ncnc2c1CCN(C(=O)CC1C=CCC1)CC2 |
| InChI | InChI=1S/C19H28N4O2/c1-25-12-4-9-20-19-16-7-10-23(11-8-17(16)21-14-22-19)18(24)13-15-5-2-3-6-15/h2,5,14-15H,3-4,6-13H2,1H3,(H,20,21,22) |
| InChIKey | ABIUMCDJLRRDLV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|