C20H28N4O2 — CID 56891811
(4aS,8aR)-6-[(4,5-dimethylfuran-2-yl)methyl]-1-[2-(1H-imidazol-5-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56891811) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (4aS,8aR)-6-[(4,5-dimethylfuran-2-yl)methyl]-1-[2-(1H-imidazol-5-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-[(4,5-dimethylfuran-2-yl)methyl]-1-[2-(1H-imidazol-5-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56891811 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (4aS,8aR)-6-[(4,5-dimethylfuran-2-yl)methyl]-1-[2-(1H-imidazol-5-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | Cc1cc(CN2CC[C@@H]3[C@@H](CCC(=O)N3CCc3cnc[nH]3)C2)oc1C |
| InChI | InChI=1S/C20H28N4O2/c1-14-9-18(26-15(14)2)12-23-7-6-19-16(11-23)3-4-20(25)24(19)8-5-17-10-21-13-22-17/h9-10,13,16,19H,3-8,11-12H2,1-2H3,(H,21,22)/t16-,19+/m0/s1 |
| InChIKey | YGTYJEMRVIAJMA-QFBILLFUSA-N |
| XLogP | 2.68 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |