C22H26N2O3 — CID 56891954
5-[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-1-methylpyridin-2-one (PubChem CID 56891954) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 5-[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-1-methylpyridin-2-one.
| Compound Name | 5-[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 56891954 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 5-[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(C(=O)N2CC[C@@](O)(c3ccccc3)[C@H]3CCCC[C@@H]32)ccc1=O |
| InChI | InChI=1S/C22H26N2O3/c1-23-15-16(11-12-20(23)25)21(26)24-14-13-22(27,17-7-3-2-4-8-17)18-9-5-6-10-19(18)24/h2-4,7-8,11-12,15,18-19,27H,5-6,9-10,13-14H2,1H3/t18-,19-,22+/m0/s1 |
| InChIKey | YLPSVEYXMKZKRG-CNNODRBYSA-N |
| XLogP | 2.68 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |