C16H23NO3 — CID 56892056
1-[3-hydroxy-3-(hydroxymethyl)piperidin-1-yl]-3-(4-methylphenyl)propan-1-one (PubChem CID 56892056) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 1-[3-hydroxy-3-(hydroxymethyl)piperidin-1-yl]-3-(4-methylphenyl)propan-1-one.
| Compound Name | 1-[3-hydroxy-3-(hydroxymethyl)piperidin-1-yl]-3-(4-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 56892056 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 1-[3-hydroxy-3-(hydroxymethyl)piperidin-1-yl]-3-(4-methylphenyl)propan-1-one |
| SMILES | Cc1ccc(CCC(=O)N2CCCC(O)(CO)C2)cc1 |
| InChI | InChI=1S/C16H23NO3/c1-13-3-5-14(6-4-13)7-8-15(19)17-10-2-9-16(20,11-17)12-18/h3-6,18,20H,2,7-12H2,1H3 |
| InChIKey | QUIYIAUCJBTOIO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |