C19H26N4O2 — CID 56892446
(4aS,8aR)-6-(1H-imidazol-5-ylmethyl)-1-[2-(5-methylfuran-2-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56892446) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (4aS,8aR)-6-(1H-imidazol-5-ylmethyl)-1-[2-(5-methylfuran-2-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-(1H-imidazol-5-ylmethyl)-1-[2-(5-methylfuran-2-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56892446 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (4aS,8aR)-6-(1H-imidazol-5-ylmethyl)-1-[2-(5-methylfuran-2-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | Cc1ccc(CCN2C(=O)CC[C@H]3CN(Cc4cnc[nH]4)CC[C@H]32)o1 |
| InChI | InChI=1S/C19H26N4O2/c1-14-2-4-17(25-14)6-9-23-18-7-8-22(12-16-10-20-13-21-16)11-15(18)3-5-19(23)24/h2,4,10,13,15,18H,3,5-9,11-12H2,1H3,(H,20,21)/t15-,18+/m0/s1 |
| InChIKey | WYIXPUANSUCJTG-MAUKXSAKSA-N |
| XLogP | 2.37 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |