About N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide
N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide (PubChem CID 56892786) has the molecular formula C18H24N4O2
and a molecular weight of 328.42 g/mol. Its IUPAC name is N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide |
| PubChem CID | 56892786 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCC2(CCN(c3ccc4cc[nH]c4n3)CC2)O1 |
| InChI | InChI=1S/C18H24N4O2/c1-13(23)20-12-15-4-6-18(24-15)7-10-22(11-8-18)16-3-2-14-5-9-19-17(14)21-16/h2-3,5,9,15H,4,6-8,10-12H2,1H3,(H,19,21)(H,20,23) |
| InChIKey | PPDKSERDDNWTAH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide?
The IUPAC name of N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide (CID 56892786) is N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide.
What is the SMILES notation for N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide?
The canonical SMILES for N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide is CC(=O)NCC1CCC2(CCN(c3ccc4cc[nH]c4n3)CC2)O1.
What is the InChIKey of N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide?
The InChIKey is PPDKSERDDNWTAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O2/c1-13(23)20-12-15-4-6-18(24-15)7-10-22(11-8-18)16-3-2-14-5-9-19-17(14)21-16/h2-3,5,9,15H,4,6-8,10-12H2,1H3,(H,19,21)(H,20,23).
What are the key properties of N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide?
N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide has a molecular weight of 328.42 g/mol, XLogP of 2.22, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[8-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]acetamide is sourced from PubChem (CID 56892786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).