C17H26N4OS — CID 56893419
(4aS,8aR)-6-(6-methylpyridazin-3-yl)-1-(3-methylsulfanylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56893419) has the molecular formula C17H26N4OS and a molecular weight of 334.49 g/mol. Its IUPAC name is (4aS,8aR)-6-(6-methylpyridazin-3-yl)-1-(3-methylsulfanylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-(6-methylpyridazin-3-yl)-1-(3-methylsulfanylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56893419 |
| Molecular Formula | C17H26N4OS |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (4aS,8aR)-6-(6-methylpyridazin-3-yl)-1-(3-methylsulfanylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CSCCCN1C(=O)CC[C@H]2CN(c3ccc(C)nn3)CC[C@H]21 |
| InChI | InChI=1S/C17H26N4OS/c1-13-4-6-16(19-18-13)20-10-8-15-14(12-20)5-7-17(22)21(15)9-3-11-23-2/h4,6,14-15H,3,5,7-12H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | HJYCKCFOQXLFTM-LSDHHAIUSA-N |
| XLogP | 2.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|