C18H25N3O — CID 56893517
(3aR,7aS)-2-(2-pyrimidin-2-yloxyhex-5-enyl)-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 56893517) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is (3aR,7aS)-2-(2-pyrimidin-2-yloxyhex-5-enyl)-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | (3aR,7aS)-2-(2-pyrimidin-2-yloxyhex-5-enyl)-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 56893517 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (3aR,7aS)-2-(2-pyrimidin-2-yloxyhex-5-enyl)-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | C=CCCC(CN1C[C@H]2CC=CC[C@H]2C1)Oc1ncccn1 |
| InChI | InChI=1S/C18H25N3O/c1-2-3-9-17(22-18-19-10-6-11-20-18)14-21-12-15-7-4-5-8-16(15)13-21/h2,4-6,10-11,15-17H,1,3,7-9,12-14H2/t15-,16+,17? |
| InChIKey | YAYYEQOIBDNFRK-SJPCQFCGSA-N |
| XLogP | 3.09 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|