C19H25N3O2 — CID 56893571
(3aR,5R,6S,7aS)-2-[[1-(3-methylphenyl)pyrazol-4-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol (PubChem CID 56893571) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (3aR,5R,6S,7aS)-2-[[1-(3-methylphenyl)pyrazol-4-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol.
| Compound Name | (3aR,5R,6S,7aS)-2-[[1-(3-methylphenyl)pyrazol-4-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
|---|---|
| PubChem CID | 56893571 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (3aR,5R,6S,7aS)-2-[[1-(3-methylphenyl)pyrazol-4-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
| SMILES | Cc1cccc(-n2cc(CN3C[C@H]4C[C@H](O)[C@H](O)C[C@H]4C3)cn2)c1 |
| InChI | InChI=1S/C19H25N3O2/c1-13-3-2-4-17(5-13)22-10-14(8-20-22)9-21-11-15-6-18(23)19(24)7-16(15)12-21/h2-5,8,10,15-16,18-19,23-24H,6-7,9,11-12H2,1H3/t15-,16+,18+,19- |
| InChIKey | CPKXGISSCFWDEV-XHVUQVIVSA-N |
| XLogP | 1.74 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |