C21H32N2O2 — CID 56893865
5-[(2R,3R,6R)-3-(3-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]pentan-1-ol (PubChem CID 56893865) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 5-[(2R,3R,6R)-3-(3-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]pentan-1-ol.
| Compound Name | 5-[(2R,3R,6R)-3-(3-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]pentan-1-ol |
|---|---|
| PubChem CID | 56893865 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 5-[(2R,3R,6R)-3-(3-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]pentan-1-ol |
| SMILES | COc1cccc([C@@H]2CN(CCCCCO)[C@@H]3C4CCN(CC4)[C@@H]32)c1 |
| InChI | InChI=1S/C21H32N2O2/c1-25-18-7-5-6-17(14-18)19-15-23(10-3-2-4-13-24)20-16-8-11-22(12-9-16)21(19)20/h5-7,14,16,19-21,24H,2-4,8-13,15H2,1H3/t19-,20+,21+/m0/s1 |
| InChIKey | MHAFGLPQLDGBJT-PWRODBHTSA-N |
| XLogP | 2.72 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|