C17H25F2N5O — CID 56894250
4-(3,3-difluoropiperidin-1-yl)-N,N,2-trimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxamide (PubChem CID 56894250) has the molecular formula C17H25F2N5O and a molecular weight of 353.42 g/mol. Its IUPAC name is 4-(3,3-difluoropiperidin-1-yl)-N,N,2-trimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxamide.
| Compound Name | 4-(3,3-difluoropiperidin-1-yl)-N,N,2-trimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxamide |
|---|---|
| PubChem CID | 56894250 |
| Molecular Formula | C17H25F2N5O |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-(3,3-difluoropiperidin-1-yl)-N,N,2-trimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxamide |
| SMILES | Cc1nc2c(c(N3CCCC(F)(F)C3)n1)CCN(C(=O)N(C)C)CC2 |
| InChI | InChI=1S/C17H25F2N5O/c1-12-20-14-6-10-23(16(25)22(2)3)9-5-13(14)15(21-12)24-8-4-7-17(18,19)11-24/h4-11H2,1-3H3 |
| InChIKey | HGQQSDJVWCZKCP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |