About 1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol
1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol (PubChem CID 56894320) has the molecular formula C18H27NO2
and a molecular weight of 289.42 g/mol. Its IUPAC name is 1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol.
Molecular Properties
| Compound Name | 1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol |
| PubChem CID | 56894320 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol |
| SMILES | CCCOCCN1CCC2(CC1)c1ccccc1CC2O |
| InChI | InChI=1S/C18H27NO2/c1-2-12-21-13-11-19-9-7-18(8-10-19)16-6-4-3-5-15(16)14-17(18)20/h3-6,17,20H,2,7-14H2,1H3 |
| InChIKey | PCNSFEFRTLBNJY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol?
The IUPAC name of 1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol (CID 56894320) is 1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol.
What is the SMILES notation for 1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol?
The canonical SMILES for 1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol is CCCOCCN1CCC2(CC1)c1ccccc1CC2O.
What is the InChIKey of 1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol?
The InChIKey is PCNSFEFRTLBNJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO2/c1-2-12-21-13-11-19-9-7-18(8-10-19)16-6-4-3-5-15(16)14-17(18)20/h3-6,17,20H,2,7-14H2,1H3.
What are the key properties of 1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol?
1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol has a molecular weight of 289.42 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(2-propoxyethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol is sourced from PubChem (CID 56894320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).